For research use only. Not for therapeutic Use.
[Cyclopropylidene(phenyl)methyl]benzene is an organic compound featuring a cyclopropylidene group attached to a benzyl moiety, with a phenyl substituent. The structure showcases a three-membered cyclopropyl ring, which imparts unique steric and electronic properties to the molecule. This compound is of interest in synthetic organic chemistry due to its potential reactivity and utility in constructing more complex organic structures. Its distinctive arrangement may also contribute to studies involving reaction mechanisms and the behavior of cyclic compounds in various chemical contexts.
CAS Number | 7632-57-7 |
Molecular Formula | C16H14 |
Purity | ≥95% |
IUPAC Name | [cyclopropylidene(phenyl)methyl]benzene |
InChI | InChI=1S/C16H14/c1-3-7-13(8-4-1)16(15-11-12-15)14-9-5-2-6-10-14/h1-10H,11-12H2 |
InChIKey | WHNHNDHFSZUBCN-UHFFFAOYSA-N |
SMILES | C1CC1=C(C2=CC=CC=C2)C3=CC=CC=C3 |