For research use only. Not for therapeutic Use.
Cyclotetrakis(1,4-butylene terephthalate) is a cyclic oligomer composed of repeating 1,4-butylene terephthalate units. This compound is a type of macrocyclic polyester and belongs to the family of cyclodextrins. Cyclotetrakis(1,4-butylene terephthalate) exhibits unique properties due to its cyclic structure, including encapsulation capabilities and guest molecule binding. It is utilized in materials science, particularly in the development of functional materials, drug delivery systems, and molecular recognition devices. Research focuses on exploring its applications in various fields, such as catalysis, separation, and biomedicine, driven by its versatile chemical and structural characteristics.
Catalog Number | R064166 |
CAS Number | 29278-72-6 |
Synonyms | 3,8,15,20,27,32,39,44-Octaoxapentacyclo[44.2.2.210,13.222,25.234,37]hexapentaconta-10,11,12,22,23,24,34,35,36,46,48,49-dodecaene-2,9,14,21,26,33,38,45-octone; ?3,8,15,20,27,32,39,44-Octaoxapentacyclo[44.2.2.210,13.222,25.234,37]hexapentaconta-10,12,2 |
Molecular Formula | C48H48O16 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C48H48O16/c49-41-33-9-11-35(12-10-33)43(51)59-27-3-4-29-61-45(53)37-17-19-39(20-18-37)47(55)63-31-7-8-32-64-48(56)40-23-21-38(22-24-40)46(54)62-30-6-5-28-60-44(52)36-15-13-34(14-16-36)42(50)58-26-2-1-25-57-41/h9-24H,1-8,25-32H2 |
InChIKey | HZVHSLWVAJMAKH-UHFFFAOYSA-N |
SMILES | C1CCOC(=O)C2=CC=C(C=C2)C(=O)OCCCCOC(=O)C3=CC=C(C=C3)C(=O)OCCCCOC(=O)C4=CC=C(C=C4)C(=O)OCCCCOC(=O)C5=CC=C(C=C5)C(=O)OC1 |