For research use only. Not for therapeutic Use.
Cyclotris(1,4-butylene terephthalate) is a cyclic oligomer composed of repeating units of 1,4-butylene terephthalate. It is a precursor in the synthesis of polybutylene terephthalate (PBT), a thermoplastic polyester known for its strength, durability, and resistance to chemicals and heat. Cyclotris(1,4-butylene terephthalate) plays a crucial role in the polymerization process, influencing the properties of the resulting PBT. This compound is of interest in materials science for its potential applications in the production of high-performance plastics, fibers, and engineering resins used in automotive, electronics, and industrial components.
Catalog Number | R057692 |
CAS Number | 63440-94-8 |
Synonyms | 3,8,15,20,27,32-Hexaoxatetracyclo[32.2.2.210,13.222,25]dotetraconta-10,12,22,24,34,36,37,39,41-nonaene-2,9,14,21,26,33-hexone; PBT Cyclic Trimer; 3,8,15,20,27,32-Hexaoxatetracyclo[32.2.2.210,13.222,25]dotetraconta-1(36),10,11,13(12),22,23,25(24),34,3 |
Molecular Formula | C36H36O12 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 3,8,15,20,27,32-hexaoxatetracyclo[32.2.2.210,13.222,25]dotetraconta-1(37),10,12,22(40),23,25(39),34(38),35,41-nonaene-2,9,14,21,26,33-hexone |
InChI | InChI=1S/C36H36O12/c37-31-25-7-9-27(10-8-25)33(39)45-21-3-4-23-47-35(41)29-15-17-30(18-16-29)36(42)48-24-6-5-22-46-34(40)28-13-11-26(12-14-28)32(38)44-20-2-1-19-43-31/h7-18H,1-6,19-24H2 |
InChIKey | HRNLXZWSSMMFMP-UHFFFAOYSA-N |
SMILES | C1CCOC(=O)C2=CC=C(C=C2)C(=O)OCCCCOC(=O)C3=CC=C(C=C3)C(=O)OCCCCOC(=O)C4=CC=C(C=C4)C(=O)OC1 |