For research use only. Not for therapeutic Use.
CycLuc7 is a cyclic alkylaminoluciferin substrate for firefly luciferase.
| Catalog Number | I025404 |
| CAS Number | 1393650-89-9 |
| Synonyms | CycLuc7; CycLuc 7; CycLuc-7 |
| Molecular Formula | C14H13N3O2S2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-(5,6,7,8-Tetrahydrothiazolo[4,5-g]quinolin-2-yl)-4,5-dihydrothiazole-4-carboxylic acid |
| InChI | InChI=1S/C14H13N3O2S2/c18-14(19)10-6-20-12(17-10)13-16-9-4-7-2-1-3-15-8(7)5-11(9)21-13/h4-5,10,15H,1-3,6H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | BKYMBDMQGNICFU-SNVBAGLBSA-N |
| SMILES | O=C([C@@H]1N=C(C(S2)=NC3=C2C=C4NCCCC4=C3)SC1)O |
