For research use only. Not for therapeutic Use.
CYM 50308 is a novel agonist of SIP4 (EC50 = 56 nM) that displays 37-fold selectivity against S1P5 (EC50 = 2.1 μM) and no appreciable activity over the S1P1-3 subtypes at concentrations up to 25 μM.
| Catalog Number | R061536 |
| CAS Number | 1345858-76-5 |
| Synonyms | (2Z,5Z)-5-[[1-(2,4-Difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylene]-2-[(2-methoxyethyl)imino]-3-methyl-4-thiazolidinone |
| Molecular Formula | C20H21F2N3O2S |
| Purity | ≥95% |
| Target | LPL Receptor |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at +4C |
| IUPAC Name | (5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one |
| InChI | InChI=1S/C20H21F2N3O2S/c1-12-9-14(13(2)25(12)17-6-5-15(21)11-16(17)22)10-18-19(26)24(3)20(28-18)23-7-8-27-4/h5-6,9-11H,7-8H2,1-4H3/b18-10-,23-20? |
| InChIKey | BKQZKTRCUAWRHT-ONBPWHQPSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=C(C=C2)F)F)C)C=C3C(=O)N(C(=NCCOC)S3)C |
