For research use only. Not for therapeutic Use.
CYM 50769（Cat No.:I010683）is a selective and potent inhibitor of the enzyme protein kinase C theta (PKCθ), which plays a key role in immune cell signaling, particularly in T-cell activation. By inhibiting PKCθ, CYM 50769 can modulate immune responses and is being investigated for its potential therapeutic applications in autoimmune diseases and inflammatory conditions. Research suggests that CYM 50769 may help to reduce excessive immune activation, making it a promising candidate for treating diseases such as rheumatoid arthritis, psoriasis, and potentially other immune-related disorders.
| CAS Number | 1421365-63-0 |
| Synonyms | 5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one |
| Molecular Formula | C24H17ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one |
| InChI | InChI=1S/C24H17ClN2O3/c1-29-15-10-12-16(13-11-15)30-23-21(25)14-26-27(24(23)28)22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-14,22H,1H3 |
| InChIKey | QHVSQUYCVUHYKT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=NN(C2=O)C3C4=CC=CC=C4C5=CC=CC=C35)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
