For research use only. Not for therapeutic Use.
Cynarin(Cat No.: M048038) is a bioactive compound found primarily in artichokes (Cynara scolymus), known for its antioxidant, anti-inflammatory, and hepatoprotective properties. It is a dicaffeoylquinic acid derivative, believed to support liver health by promoting bile production and improving digestion. Cynarin also has potential benefits for cardiovascular health by helping lower cholesterol levels and improving blood circulation. Additionally, research suggests it may have neuroprotective effects and be useful in managing conditions like hyperlipidemia and liver disease, though further studies are needed.
| CAS Number | 1182-34-9 |
| Molecular Formula | C25H24O12 |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Storage | Desiccate at +4℃ |
| IUPAC Name | (1R,3R,4S,5R)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylic acid |
| InChI | 1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
| InChIKey | YDDUMTOHNYZQPO-RVXRWRFUSA-N |
| SMILES | C1[C@H]([C@@H]([C@@H](C[C@]1(C(=O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O |
