For research use only. Not for therapeutic Use.
Cyprodinil（Cat No.:R055912）, is a broad-spectrum fungicide used in agriculture to control fungal diseases in various crops. It inhibits fungal cell growth and spore germination, effectively combating powdery mildews, botrytis, and rust diseases. Cyprodinil is applied through foliar sprays, seed treatments, or soil drenches. It is used in rotation or combination with other fungicides to manage resistance. Cyprodinil plays a vital role in protecting crops, promoting sustainable agriculture, and enhancing crop productivity by effectively managing fungal infections.
| Catalog Number | R055912 |
| CAS Number | 121552-61-2 |
| Synonyms | 4-Cyclopropyl-6-methyl-N-phenyl-2-pyrimidinamine; CGA 219417; Chorus 75WG; Unix; Vangard; |
| Molecular Formula | C14H15N3 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Storage | -20°C |
| IUPAC Name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
| InChI | InChI=1S/C14H15N3/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,15,16,17) |
| InChIKey | HAORKNGNJCEJBX-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=C1)C2CC2)NC3=CC=CC=C3 |
