For research use only. Not for therapeutic Use.
Cytarabine (Cat No.:A000876) is a chemotherapy drug primarily used to treat hematologic cancers, such as leukemia and lymphoma. It is a nucleoside analog that interferes with DNA synthesis by inhibiting DNA polymerase and incorporating itself into DNA strands, causing cell death. Cytarabine is most effective against rapidly dividing cancer cells. It is typically administered intravenously or via intrathecal injection (into the cerebrospinal fluid) for certain leukemia types. Common side effects include myelosuppression, nausea, vomiting, and potential neurotoxicity, especially with high-dose treatment. It is a key agent in many chemotherapy regimens.
CAS Number | 147-94-4 |
Synonyms | NA |
Molecular Formula | C9H13N3O5 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Limited solubility |
Storage | 3 years -20C powder |
IUPAC Name | 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
InChIKey | UHDGCWIWMRVCDJ-CCXZUQQUSA-N |
SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |