For research use only. Not for therapeutic Use.
Cytidine (Cat No.: A000454) is a nucleoside composed of the base cytosine and the sugar ribose. It is a key component of RNA and plays an essential role in various biochemical processes, including protein synthesis and cellular metabolism. Cytidine is involved in the synthesis of cyclic AMP (cAMP) and CDP-choline, which are crucial for cell signaling and phospholipid metabolism. It is also studied for its potential neuroprotective effects and has been investigated in treatments for neurodegenerative diseases like Alzheimer’s.
CAS Number | 65-46-3 |
Synonyms | NA |
Molecular Formula | C9H13N3O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | >11.9mg/mL in DMSO |
Storage | store at -20℃ |
IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
InChI | 1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 |
InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N |
SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |