For research use only. Not for therapeutic Use.
Cytisine(CAT: R000068) is an alkaloid compound that is found in various plants, including the seeds of the Laburnum, Golden Chain, and Baptisia tinctoria. Cytisine has been used as a smoking cessation aid due to its ability to bind to nicotinic acetylcholine receptors in the brain. It has been shown to have similar effects to nicotine, but with fewer side effects and a lower risk of addiction. In addition to its potential use in smoking cessation therapy, Cytisine has also been investigated for its potential as a treatment for various other conditions, such as Parkinson’s disease, depression, and Alzheimer’s disease.
| Catalog Number | R000068 |
| CAS Number | 485-35-8 |
| Synonyms | (1R,5S)-1,2,3,4,5,6-Hexahydro-1,5-Methano-8H-pyrido[1,2-a][1,5]diazocin-8-one; ?(-)-Cytisine; Baptitoxin; Baptitoxine; Cytisin; Cytiton; Cytitone; Laburnin; Sophorin; Sophorine; Tabex; Tsitafat; Ulexin; Ulexine; |
| Molecular Formula | C11H14N2O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | 3 years -20C powder |
| InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| InChIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| SMILES | C1C2CNCC1C3=CC=CC(=O)N3C2 |
