For research use only. Not for therapeutic Use.
CZC-54252(Cat No.:I000695) a chemical compound that acts as a selective inhibitor of certain kinases, primarily targeting protein kinases involved in cellular signaling pathways. It has been investigated for its potential therapeutic effects in treating various diseases, including cancer and autoimmune disorders. Its precise mechanism of action involves modulating cellular processes like proliferation and apoptosis. However, its clinical development and approval status may still be under investigation, with ongoing research to confirm efficacy and safety profiles.
| Catalog Number | I000695 |
| CAS Number | 1191911-27-9 |
| Synonyms | (E)-N-(2-((5-chloro-2-((2-methoxy-4-morpholinophenyl)amino)pyrimidin-4(3H)-ylidene)amino)phenyl)methanesulfonamide hydrochloride |
| Molecular Formula | C₂₂H₂₅ClN₆O₄S.HCl |
| Purity | ≥95% |
| Target | LRRK2 |
| Solubility | 100 mM in DMSO |
| Storage | -20°C |
| IC50 | 1.28 nM/1.85 nM(LRRK2/G2019S LRRK2) |
| IUPAC Name | N-[2-[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]methanesulfonamide |
| InChI | InChI=1S/C22H25ClN6O4S/c1-32-20-13-15(29-9-11-33-12-10-29)7-8-19(20)26-22-24-14-16(23)21(27-22)25-17-5-3-4-6-18(17)28-34(2,30)31/h3-8,13-14,28H,9-12H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | CLGWUCNXOBLWFM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCOCC2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NS(=O)(=O)C)Cl |
