For research use only. Not for therapeutic Use.
D-Ala-D-Ala（Cat No.:I043246）is a dipeptide consisting of two D-alanine molecules linked by a peptide bond. It is a key component in bacterial cell wall synthesis, particularly in the peptidoglycan structure. D-Ala-D-Ala serves as a substrate for transpeptidase enzymes during the final stages of cell wall formation, contributing to the structural integrity of bacterial cells. It is also the target of certain antibiotics, such as vancomycin, which inhibit cell wall synthesis by binding to the D-Ala-D-Ala terminal, preventing bacterial growth. This compound is widely studied in microbiology and antibiotic resistance research.
| CAS Number | 923-16-0 |
| Synonyms | (2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoic acid |
| Molecular Formula | C6H12N2O3 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoic acid |
| InChI | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m1/s1 |
| InChIKey | DEFJQIDDEAULHB-QWWZWVQMSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
