For research use only. Not for therapeutic Use.
D-Azetidine-2-carboxylic Acid(CAT: R001142) is a chemical compound that belongs to the family of azetidine carboxylic acids. It is a four-membered ring containing a nitrogen atom and a carboxylic acid group. This compound has been of interest in organic and medicinal chemistry due to its unique structure and potential applications. It could serve as a building block in the synthesis of various compounds and can potentially be used in drug design and development.
CAS Number | 7729-30-8 |
Synonyms | (2R)-2-Azetidinecarboxylic Acid; (+)-Azetidinecarboxylic Acid; |
Molecular Formula | C4H7NO2 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | (2R)-azetidine-2-carboxylic acid |
InChI | InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1 |
InChIKey | IADUEWIQBXOCDZ-GSVOUGTGSA-N |
SMILES | C1CNC1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |