For research use only. Not for therapeutic Use.
D-Cysteine (Cat.No:R061396) is an enantiomer of the amino acid cysteine. It is a non-proteinogenic amino acid and serves as a crucial building block in the biosynthesis of various biologically active molecules. D-Cysteine plays a significant role in cellular processes and has potential applications in pharmaceutical and biochemical research.
CAS Number | 921-01-7 |
Synonyms | (S)-Cysteine |
Molecular Formula | C3H7NO2S |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-3-sulfanylpropanoic acid |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1 |
InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-N |
SMILES | C(C(C(=O)O)N)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |