For research use only. Not for therapeutic Use.
D-Dimannuronic acid is an alginate extract from brown algae which can be used to synthesize sulfated polymannuronate (SPMG)-derived oligosaccharides[1].
| Catalog Number | I040816 |
| Synonyms | sodium;(2S,3S,4S,5S,6R)-6-[(2S,3S,4R,5S,6R)-2-carboxy-4,5,6-trihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| Molecular Formula | C12H17NaO13 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H18O13.Na/c13-1-2(14)7(9(18)19)25-12(5(1)17)24-6-3(15)4(16)11(22)23-8(6)10(20)21;/h1-8,11-17,22H,(H,18,19)(H,20,21);/q;+1/p-1/t1-,2-,3+,4-,5-,6-,7-,8-,11+,12+;/m0./s1 |
| InChIKey | KWEWZYQXSGQEFZ-RJCNRZPOSA-M |
| SMILES | C1(C(C(OC(C1O)OC2C(C(C(OC2C(=O)O)O)O)O)C(=O)[O-])O)O.[Na+] |
| Reference | [1]. Liu H, et, al. Multiple and multivalent interactions of novel anti-AIDS drug candidates, sulfated polymannuronate (SPMG)-derived oligosaccharides, with gp120 and their anti-HIV activities. Glycobiology. 2005 May; 15(5):501-10. |
