D-Fructose-1-13C is an isotopically labeled form of D-fructose, where the carbon atom at the 1-position is replaced with the carbon-13 isotope. This compound is commonly used in metabolic research, particularly in studies involving carbohydrate metabolism, glycolysis, and fructose metabolism pathways. The incorporation of carbon-13 allows for precise tracking and quantification in analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, providing detailed insights into metabolic flux and the biochemical fate of fructose in various biological systems. D-Fructose-1-13C is essential for researchers studying metabolic disorders, energy production, and the role of fructose in health and disease, offering reliable data for understanding complex metabolic processes.
| Catalog Number | R041130 |
| CAS Number | 108311-21-3 |
| Synonyms | Advantose FS 95-1-13C; D-(-)-Fructose-1-13C; D-(-)-Levulose-1-13C; D-Arabino-2-hexulose-1-13C; Fructose-1-13C; Fruit Sugar-1-13C; Fujifructo L 95-1-13C; Furucton-1-13C; Hi-Fructo 970-1-13C; Krystar-1-13C; Krystar 300-1-13C; Levulose-1-13C; Nevulose-1 |
| Molecular Formula | C₅¹³CH₁₂O₆ |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3S,4R,5R)-2-(hydroxy(113C)methyl)oxane-2,3,4,5-tetrol |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6?/m1/s1/i2+1 |
| InChIKey | LKDRXBCSQODPBY-BORCATHGSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](C(O1)([13CH2]O)O)O)O)O |
