D-Fructose-13C2(Cat No.:S000529) is an isotopically labeled form of D-fructose, where two of its carbon atoms are replaced with carbon-13 (13C). D-fructose is a naturally occurring sugar found in many plants, and fruits, and is a key component in human metabolism, primarily involved in energy production. The incorporation of 13C isotopes in D-fructose-13C2 enhances its traceability in metabolic studies, allowing researchers to observe and analyze how fructose is metabolized in biological systems. This enhanced visibility is crucial for studies focused on understanding fructose’s role in health conditions like diabetes and obesity.
Catalog Number | S000529 |
CAS Number | 2483736-14-5 |
Molecular Formula | C413C2H12O6 |
Purity | 95% |
IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxy(1,2-13C2)hexan-2-one |
InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1/i2+1,4+1 |
InChIKey | BJHIKXHVCXFQLS-DJNMHOOTSA-N |
SMILES | C(C(C(C(C(=O)CO)O)O)O)O |