D-Fructose-13C6（Cat No.:R041146） is an isotopically labeled form of D-Fructose, where all six carbon atoms are enriched with carbon-13. This modification significantly enhances its detectability in nuclear magnetic resonance (NMR) and mass spectrometry, making it an invaluable tool for metabolic and enzymatic studies. D-Fructose-13C6 is crucial for researching carbohydrate metabolism and its implications in various health conditions, including diabetes and metabolic syndrome. The isotopic labeling allows researchers to trace the metabolic pathways of fructose accurately, providing deeper insights into its conversion into other sugars and its role in energy production and storage.
| Catalog Number | R041146 |
| CAS Number | 201595-65-5 |
| Synonyms | Advantose FS 95-13C6; D-(-)-Fructose-13C6; D-(-)-Levulose-13C6; D-Arabino-2-hexulose-13C6; Fructose-13C6; Fruit Sugar-13C6; Fujifructo L 95-13C6; Furucton-13C6; Hi-Fructo 970;-13C6 Krystar-13C6; Krystar 300-13C6; Levulose-13C6; Nevulose-13C6; Sugar F |
| Molecular Formula | ¹³C₆H₁₂O₆ |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexan-2-one |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | BJHIKXHVCXFQLS-HJLYHLTLSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C](=O)[13CH2]O)O)O)O)O |
