D-Galactose-13C6 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of D-Galactose, labeled with six carbon-13 atoms, is pivotal for studies involving carbohydrate metabolism, glycosylation processes, and metabolic pathway analysis. Featuring stable isotope labeling, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for biochemistry research and drug development, D-Galactose-13C6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S001035 |
| CAS Number | 74134-89-7 |
| Molecular Formula | 13C6H12O6 |
| Purity | % |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy(1,2,3,4,5,6-13C6)hexanal |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | GZCGUPFRVQAUEE-CPRVWCQRSA-N |
| SMILES | [13CH2]([13C@H]([13C@@H]([13C@@H]([13C@H]([13CH]=O)O)O)O)O)O |
