D-Galacturonic Acid-13C6 is an isotopically labeled form of D-galacturonic acid, where all six carbon atoms are enriched with the stable carbon-13 isotope. This compound is widely used in biochemical and analytical research, particularly in the study of carbohydrate metabolism, plant cell wall structure, and pectin degradation. The 13C labeling enables precise tracking and analysis in NMR spectroscopy and mass spectrometry, making it invaluable for investigating the metabolic pathways and biological roles of uronic acids in various organisms. Researchers utilize D-Galacturonic Acid-13C6 to gain deeper insights into the biosynthesis and breakdown of polysaccharides, aiding in the development of applications in agriculture, food science, and biotechnology.
| Catalog Number | R044887 |
| CAS Number | NA |
| Synonyms | Galacturonic acid-13C6; NSC 212542-13C6 |
| Molecular Formula | ¹³C₆H₁₀O₇ |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5,6-tetrahydroxy(2,3,4,5,6-13C5)oxane-2-carboxylic acid |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6?/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | AEMOLEFTQBMNLQ-YJCJXNJCSA-N |
| SMILES | [13C@@H]1([13C@H]([13C@H](O[13CH]([13C@@H]1O)O)[13C](=O)O)O)O |
