For research use only. Not for therapeutic Use.
D-Glucitol-13C6(Cat No.:R041216), also known as Sorbitol-13C6, is a fully labeled isotopic variant of sorbitol, where each carbon atom incorporates a stable isotope of carbon-13. This specialized compound is crucial for metabolic studies, providing enhanced tracing capabilities in metabolic pathway analysis through mass spectrometry. It is widely used in research on sugar alcohol metabolism, diabetic studies, and gastrointestinal absorption processes. D-Glucitol-13C6 is indispensable in developing pharmaceuticals and nutritional studies, facilitating precise measurement of metabolic flux and the impact of sorbitol in various biological systems.
Catalog Number | R041216 |
CAS Number | 121067-66-1 |
Synonyms | D-Sorbitol-13C6; Glucarine-13C6; Esasorb-13C6; Cholaxine-13C6; Karion-13C6; Sionite-13C6; Sionon-13C6; |
Molecular Formula | C6H14O6 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (2S,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol |
InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | FBPFZTCFMRRESA-GVZKVBLJSA-N |
SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C@H]([13CH2]O)O)O)O)O)O |