For research use only. Not for therapeutic Use.
D-Gluconic acid potassium salt(CAT: R031382) is a chemical compound that belongs to the group of organic acids. Its mode of action involves being the potassium salt of D-gluconic acid, a six-carbon sugar acid. This compound has various industrial and food-related applications. In the food industry, it is used as a sequestrant and acidity regulator, enhancing the stability and shelf life of certain food products. In agriculture, it is utilized as a fertilizer additive to improve nutrient availability in the soil. Additionally, D-Gluconic acid potassium salt finds use in the production of cleaning agents and in certain medical and pharmaceutical formulations.
CAS Number | 299-27-4 |
Synonyms | D-Gluconic Acid Monopotassium Salt; Gluconic acid potassium salt; Gluconsan K; Helshas K; K-IAO; Kalimozan; Kalium-Beta; Kaon; Katorin; Katrin; Potalium; Potasoral; Potassium D-gluconate; Potassium gluconate; Potassuril; Sirokal; Tumil K |
Molecular Formula | C6H11KO7(anhydrous); C6H11KO7· H2O (monohydrate) |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | potassium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
InChI | InChI=1S/C6H12O7.K/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
InChIKey | HLCFGWHYROZGBI-JJKGCWMISA-M |
SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[K+] |