For research use only. Not for therapeutic Use.
D-Glucosamine-15N Hydrochloride is a high-purity, isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of D-Glucosamine, enriched with 15N, is crucial for studying metabolic pathways, cartilage synthesis, and joint health. Its stable isotope labeling ensures precise and reliable analytical results. Ideal for applications in medicinal chemistry, nutraceutical research, and analytical chemistry, D-Glucosamine-15N Hydrochloride integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R041026 |
| CAS Number | 42927-60-6 |
| Synonyms | 2-Amino-2-deoxy-D-glucose-15N Hydrochloride |
| Molecular Formula | C6H14ClNO5 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | (2R,3R,4S,5R)-2-azanyl-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChI | InChI=1S/C6H13NO5.ClH/c7-3(1-8)5(11)6(12)4(10)2-9;/h1,3-6,9-12H,2,7H2;1H/t3-,4+,5+,6+;/m0./s1/i7+1; |
| InChIKey | CBOJBBMQJBVCMW-FGSAPNRJSA-N |
| SMILES | C(C(C(C(C(C=O)N)O)O)O)O.Cl |
