D-Glucose-1-13C（Cat No.:R041235） is a high-purity, isotopically labeled compound ideal for advanced research in biochemistry and metabolic studies. Featuring a carbon-13 isotope at the first position, this compound is crucial for tracing metabolic pathways, studying glucose metabolism, and conducting stable isotope-resolved metabolomics (SIRM). Its precise labeling ensures accurate analytical results, enhancing the reliability of experimental data. D-Glucose-1-13C is extensively used in research involving carbohydrate metabolism, disease mechanisms, and the development of therapeutic strategies. This compound integrates seamlessly into various experimental protocols, offering a robust and dependable solution for high-precision scientific investigations.
| Catalog Number | R041235 |
| CAS Number | 40762-22-9 |
| Synonyms | 1-13C-Glucose; D-[1-13C]Glucose; Glucose-1-13C; [1-13C]-D-Glucose; [1-13C]D-Glucose |
| Molecular Formula | C6H12O6 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1/i6+1 |
| InChIKey | WQZGKKKJIJFFOK-USBRANDWSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([13CH](O1)O)O)O)O)O |
