For research use only. Not for therapeutic Use.
D-Glucose-13C is a high-purity carbon-13 labeled compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of D-Glucose, featuring a carbon-13 atom, is crucial for studies involving carbohydrate metabolism, tracer experiments, and metabolic flux analysis. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for metabolic research and drug development, D-Glucose-13C integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000890 |
| CAS Number | 101615-88-7 |
| Molecular Formula | C513CH12O6 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(313C)hexanal |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i5+1 |
| InChIKey | GZCGUPFRVQAUEE-BFPMOEKFSA-N |
| SMILES | C([C@H]([C@H]([13C@@H]([C@H](C=O)O)O)O)O)O |
