For research use only. Not for therapeutic Use.
D-Glucose-6-13C(Cat No.:R041243) is a high-purity isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a carbon-13 atom at the sixth position, this labeled version of D-glucose is crucial for studying glucose metabolism, energy pathways, and cellular respiration. It enhances precision and accuracy in analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for metabolic research, drug development, and nutritional studies, D-Glucose-6-13C integrates seamlessly into existing research protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 106032-62-6 |
Synonyms | 6-13C-Glucose; D-[6-13C]Glucose; Glucose-6-13C; [6-13C]-D-Glucose; [6-13C]D-Glucose |
Molecular Formula | C6H12O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(613C)hexanal |
InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i2+1 |
InChIKey | GZCGUPFRVQAUEE-HYISWWFJSA-N |
SMILES | [13CH2]([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |