For research use only. Not for therapeutic Use.
D-Glutamine(Cat No.:I004233)is the D-isomer of the amino acid glutamine, which is naturally found in proteins and plays a vital role in cellular metabolism, nitrogen balance, and immune function. Unlike the L-glutamine isomer, which is more common in proteins, D-glutamine has been found in certain bacteria and fungi, where it contributes to cell wall biosynthesis. Research into D-glutamine’s role in mammals has suggested it may influence neurotransmission and metabolic pathways, though its physiological significance is less understood compared to its L-form. It is being explored for potential applications in metabolic diseases and microbial research.
CAS Number | 5959-95-5 |
Molecular Formula | C5H10N2O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | H2O: ≥ 32 mg/mL |
Storage | store at -20℃ |
IUPAC Name | (2R)-2,5-diamino-5-oxopentanoic acid |
InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m1/s1 |
InChIKey | ZDXPYRJPNDTMRX-GSVOUGTGSA-N |
SMILES | C(CC(=O)N)[C@H](C(=O)O)N |