D-glyceraldehyde-3-13C(Cat No.:R041264) is an isotopically labeled form of D-glyceraldehyde, featuring a carbon-13 (13C) atom at the third carbon position. This isotopic enhancement is crucial for tracing the metabolic pathways of carbohydrates and understanding their role in biological processes such as glycolysis and gluconeogenesis. Utilized predominantly in biochemical and physiological research, D-Glyceraldehyde-3-13C allows for precise observation of carbohydrate metabolism, aiding in studies related to diabetes, metabolic disorders, and energy production.
Catalog Number | R041264 |
CAS Number | 478529-50-9 |
Synonyms | (R)-2,3-Dihydroxypropanal-3-13C; (+)-Glyceraldehyde-3-13C; (R)-(+)-Glyceraldehyde-3-13C; (R)-Glyceraldehyde-3-13C; D-(+)-Glyceraldehyde-3-13C; D-Glyceraldehyde-3-13C; D-Glycerose-3-13C; NSC 91534-3-13C; Triose-3-13C |
Molecular Formula | C3H6O3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (2R)-2,3-dihydroxy(313C)propanal |
InChI | InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1/i2+1 |
InChIKey | MNQZXJOMYWMBOU-QQPKUSCQSA-N |
SMILES | [13CH2]([C@H](C=O)O)O |