For research use only. Not for therapeutic Use.
D-Leucine(CAT: R061190) is the mirror-image isomer of the natural amino acid L-Leucine. Its mode of action involves serving as an essential building block for protein synthesis in the body. Pharmacologically, D-Leucine is not used as a therapeutic drug on its own. However, it plays a crucial role in various physiological processes, just like its L-Leucine counterpart, including protein synthesis, cellular repair, and energy metabolism. D-Leucine is often used in research and as a component of specialized dietary supplements to investigate its effects on various metabolic pathways and to study the influence of chirality on biological systems.
| Catalog Number | R061190 |
| CAS Number | 328-38-1 |
| Synonyms | (R)-(-)-Leucine; (R)-4-Methyl-2-aminopentanoic Acid; (R)-Leucine; NSC 77687 |
| Molecular Formula | C6H13NO2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at +4C |
| IUPAC Name | (2R)-2-amino-4-methylpentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | ROHFNLRQFUQHCH-RXMQYKEDSA-N |
| SMILES | CC(C)CC(C(=O)O)N |
