For research use only. Not for therapeutic Use.
D-Mannitol is a naturally occurring sugar alcohol widely used in medical, pharmaceutical, and food industries. Known for its osmotic diuretic properties, it is commonly employed to reduce intracranial and intraocular pressure in medical emergencies. D-Mannitol is also utilized as a sweetener for diabetic-friendly products due to its low glycemic index and as a stabilizing agent in pharmaceuticals. Additionally, it serves as a cryoprotectant and bulking agent in various applications, making it a versatile compound in research and industry.
Catalog Number | A000559 |
CAS Number | 69-65-8 |
Synonyms | Osmitrol |
Molecular Formula | C6H14O6 |
Purity | 98% |
Target | Apoptosis |
Appearance | powder |
Storage | -20 ℃ |
IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
InChIKey | FBPFZTCFMRRESA-KVTDHHQDSA-N |
SMILES | C(C(C(C(C(CO)O)O)O)O)O |