For research use only. Not for therapeutic Use.
D-Mannose is a naturally occurring simple sugar, classified as a monosaccharide, and is an isomer of glucose. It plays an essential role in human metabolism, particularly in glycosylation, where it helps in the synthesis of glycoproteins and glycolipids. D-Mannose is commonly used as a dietary supplement, especially for its ability to prevent urinary tract infections (UTIs) by inhibiting the adhesion of bacteria, such as Escherichia coli, to the bladder wall. It is also involved in various biological processes, including immune system support. Due to its safety and efficacy, D-Mannose is widely researched and used in medical and health applications.
| Catalog Number | R000178 |
| CAS Number | 3458-28-4 |
| Synonyms | Carubinose; Seminose; NSC 26247; |
| Molecular Formula | C₆H₁₂O₆ |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-KVTDHHQDSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)O)O)O)O)O |
