D-Mannuronic acid monosaccharide is used in the preparation of mannuronic acid lactones from fucoidan. It is also used in the preparation of sodium alginate oligosaccharides, which are potential preventive and therapeutic agents for the treatment of circulatory disorders.
| Catalog Number | R090006 |
| CAS Number | 921-56-2 |
| Synonyms | D-mannuronic acid sodium salt; |
| Molecular Formula | C6H9O7Na |
| Purity | 90% |
| Appearance | powder |
| Related CAS | 6814-36-4 |
| IUPAC Name | sodium;(3S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1?,2-,3+,4?,6+;/m0./s1 |
| InChIKey | MSXHSNHNTORCAW-NMRVOGSPSA-M |
| SMILES | C1(C(C(OC(C1O)O)C(=O)[O-])O)O.[Na+] |
