For research use only. Not for therapeutic Use.
D-Panthenol-d4(Cat No.:I041408)is a deuterated form of D-Panthenol, a stable alcohol derivative of pantothenic acid (vitamin B5). It is commonly used as a tracer in metabolic studies and research involving vitamin B5 metabolism, as the deuterium isotope (d4) allows for precise tracking in biological systems. D-Panthenol-d4 is also utilized in the development of pharmaceutical, cosmetic, and skincare formulations due to its moisturizing and soothing properties. It plays a role in promoting skin barrier function, improving hydration, and supporting the overall health of the skin, making it a valuable ingredient in personal care products.
CAS Number | 2673270-00-1 |
Synonyms | (2R)-2,4-dihydroxy-3,3-dimethyl-N-(1,1,3,3-tetradeuterio-3-hydroxypropyl)butanamide |
Molecular Formula | C9H15D4NO4 |
Purity | ≥95% |
IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-(1,1,3,3-tetradeuterio-3-hydroxypropyl)butanamide |
InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1/i4D2,5D2 |
InChIKey | SNPLKNRPJHDVJA-LCCDPTQESA-N |
SMILES | [2H]C([2H])(CC([2H])([2H])O)NC(=O)[C@@H](C(C)(C)CO)O |