For research use only. Not for therapeutic Use.
D-Phenylalanine Methyl Ester Hydrochloride is a derivative of the amino acid D-phenylalanine, commonly used in peptide synthesis and pharmaceutical research. The compound consists of a D-phenylalanine backbone with a methyl ester group and a hydrochloride salt, providing enhanced solubility and stability for various chemical reactions. It serves as a crucial intermediate in the synthesis of peptide-based drugs and bioactive molecules, contributing to the development of therapies targeting conditions such as pain, inflammation, and neurological disorders. Its stereochemistry and functional groups make it essential for creating chiral compounds in medicinal chemistry and drug discovery.
CAS Number | 13033-84-6 |
Synonyms | (R)-Phenylalanine Methyl Ester Hydrochloride; Methyl (R)-Phenylalaninate Hydrochloride; Methyl D-Phenylalaninate Hydrochloride; |
Molecular Formula | C10H14ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl (2R)-2-amino-3-phenylpropanoate;hydrochloride |
InChI | InChI=1S/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-;/m1./s1 |
InChIKey | SWVMLNPDTIFDDY-SBSPUUFOSA-N |
SMILES | COC(=O)C(CC1=CC=CC=C1)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |