For research use only. Not for therapeutic Use.
D-Pinitol（Cat No.:M065332）is a naturally occurring compound found in legumes, carob, and some pine trees, known for its potential health benefits and applications in metabolic research. Structurally similar to inositol, D-pinitol has demonstrated effects in promoting insulin sensitivity, making it a promising agent in studies focused on diabetes and metabolic syndrome. It also exhibits antioxidant and anti-inflammatory properties, contributing to its appeal in nutraceuticals and therapeutic research. D-Pinitol is being explored for its ability to aid in glucose regulation, support cardiovascular health, and enhance muscle recovery, driving interest in its clinical applications.
| CAS Number | 10284-63-6 |
| Molecular Formula | C7H14O6 |
| Purity | ≥95% |
| Target | Influenza Virus |
| Storage | RT |
| IUPAC Name | (1R,2S,4S,5S)-6-methoxycyclohexane-1,2,3,4,5-pentol |
| InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4-,5-,6+,7?/m0/s1 |
| InChIKey | DSCFFEYYQKSRSV-FEPQRWDDSA-N |
| SMILES | COC1[C@@H]([C@H](C([C@@H]([C@@H]1O)O)O)O)O |
