For research use only. Not for therapeutic Use.
D-Proline (Cat No.: R048845) is the enantiomer of the naturally occurring L-proline, an amino acid that plays a crucial role in protein synthesis and structure. While L-proline is commonly found in nature, D-Proline is less abundant and is primarily utilized in specialized biochemical and pharmaceutical research. It is of interest due to its potential to influence protein folding, enzyme activity, and its application in the synthesis of peptide-based drugs. Additionally, D-Proline can be used to study stereochemistry in biological systems and to develop chiral molecules with therapeutic potential. Its unique properties make it valuable in advanced research and drug design.
Catalog Number | R048845 |
CAS Number | 344-25-2 |
Synonyms | (+)-(R)-Proline; (R)-(+)-Proline; (R)-2-Carboxypyrrolidine; (R)-Proline; (R)-Pyrrolidine-2-carboxylic Acid; D-(+)-Proline; |
Molecular Formula | C5H9NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2R)-pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1 |
InChIKey | ONIBWKKTOPOVIA-SCSAIBSYSA-N |
SMILES | C1CC(NC1)C(=O)O |