For research use only. Not for therapeutic Use.
Phytosphingosine(Cat No.:R013870) is a bioactive phospholipid known for its anticancer effects. In cancer cells, it plays a vital role in inducing apoptosis, a process of programmed cell death. Phytosphingosine achieves this by activating caspase 8, an enzyme involved in apoptotic pathways, and promoting the translocation of Bax, a pro-apoptotic protein, within the cells. These mechanisms lead to the selective elimination of cancer cells, making Phytosphingosine a promising candidate for cancer therapy research.
CAS Number | 554-62-1 |
Synonyms | (2S,3S,4R)-2-Amino-1,3,4-octadecanetriol; Phytosphingosine; (+)-D-ribo-Phytosphingosine; 4-D-Hydroxysphinganine; 4D-Hydroxysphinganine; C18-Phytosphingosine; D-ribo-1,3,4-Trihydroxy-2-aminooctadecane; |
Molecular Formula | C18H39NO3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | −20°C |
IUPAC Name | (2S,3S,4R)-2-aminooctadecane-1,3,4-triol |
InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1 |
InChIKey | AERBNCYCJBRYDG-KSZLIROESA-N |
SMILES | CCCCCCCCCCCCCCC(C(C(CO)N)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |