For research use only. Not for therapeutic Use.
D-Ribose-1-13C is an isotopically labeled form of D-ribose, with a carbon-13 isotope specifically incorporated at the first carbon position. This high-purity compound is essential for research in biochemistry, molecular biology, and metabolic studies. D-Ribose-1-13C is particularly valuable for investigating metabolic pathways involving ribose, including nucleotide biosynthesis and energy production in cells. The carbon-13 labeling allows for precise tracking and quantification in NMR spectroscopy and mass spectrometry, providing enhanced accuracy in tracing metabolic fluxes and studying enzymatic reactions. This compound is a crucial tool for researchers focused on understanding cellular metabolism, nucleic acid chemistry, and related areas, offering consistent and reliable results in various experimental settings.
CAS Number | 70849-24-0 |
Synonyms | Ribose-1-13C; D-(-)-Ribose-1-13C; |
Molecular Formula | C5H10O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy(113C)pentanal |
InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1/i1+1 +1 |
InChIKey | PYMYPHUHKUWMLA-CEQZBKKVSA-N |
SMILES | C([C@H]([C@H]([C@H]([13CH]=O)O)O)O)O |