D-Ribose-13C5 is a deuterated form of D-ribose with five carbon-13 isotopes. This labeled sugar is crucial in biochemical and pharmaceutical research due to its enhanced precision in NMR and mass spectrometry. D-Ribose is a key component of ATP (adenosine triphosphate), vital for cellular energy processes. The carbon-13 labeling allows researchers to study metabolic pathways, enzymatic reactions, and the behavior of ribose in various biological systems. It is also used in organic chemistry for synthesizing nucleotides and other biologically relevant molecules, helping to elucidate reaction mechanisms and optimize synthetic processes.
Catalog Number | R057299 |
CAS Number | 202114-47-4 |
Synonyms | Ribose-13C5; D-(-)-Ribose-13C5; D-[UL-13C5]-Ribose; |
Molecular Formula | C5H10O5 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (3R,4R,5R)-oxane-2,3,4,5-tetrol |
InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m1/s1/i1+1,2+1,3+1,4+1,5+1 |
InChIKey | HMFHBZSHGGEWLO-UWNVARNQSA-N |
SMILES | [13CH2]([13C@@H]1[13C@H]([13C@H]([13CH](O1)O)O)O)O |