For research use only. Not for therapeutic Use.
D-Ribose-5-phosphate disodium salt is a phosphorylated sugar derivative of D-ribose, where the ribose sugar is attached to a phosphate group at the 5-position and balanced with two sodium ions. It plays a key role in the pentose phosphate pathway, crucial for cellular metabolism and nucleotide synthesis. This compound is used in biochemical and molecular biology research to study metabolic processes, enzyme activity, and as a precursor for the synthesis of nucleotides and other biomolecules.
CAS Number | 18265-46-8 |
Molecular Formula | C5H9Na2O8P |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | disodium;(2R,3S,4R)-4-hydroxy-1-oxo-5-phosphonooxypentane-2,3-diolate |
InChI | 1S/C5H9O8P.2Na/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;;/h1,3-5,8H,2H2,(H2,10,11,12);;/q-2;2*+1/t3-,4+,5-;;/m0../s1 |
InChIKey | WLPAKKFQVSXILQ-LMQMBFIUSA-N |
SMILES | C([C@H]([C@H]([C@H](C=O)[O-])[O-])O)OP(=O)(O)O.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |