For research use only. Not for therapeutic Use.
D-Ribose-d5（Cat No.:I042772）is a deuterated form of D-ribose, a naturally occurring monosaccharide that plays a key role in the synthesis of nucleotides and nucleic acids, including RNA. The deuteration (replacement of hydrogen atoms with deuterium) allows for more precise tracking and analysis of metabolic pathways involving ribose in biological systems. D-Ribose-d5 is used in metabolic studies, especially in the research of cellular energy production and nucleic acid metabolism. It is also used in isotope labeling experiments and mass spectrometry to investigate metabolic dynamics and improve the understanding of biochemical processes.
| Synonyms | (2R,3R,4R)-2,3,4,5,5-pentadeuterio-2,3,4,5-tetrahydroxypentanal |
| Molecular Formula | C5H5D5O5 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4R)-2,3,4,5,5-pentadeuterio-2,3,4,5-tetrahydroxypentanal |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1/i2D2,3D,4D,5D |
| InChIKey | PYMYPHUHKUWMLA-GMNJSXRBSA-N |
| SMILES | [2H][C@](C=O)([C@@]([2H])([C@@]([2H])(C([2H])([2H])O)O)O)O |
