For research use only. Not for therapeutic Use.
D-Sedoheptulose 7-phosphate(CAT: I016675) is a key intermediate in the pentose phosphate pathway (PPP), specifically in the non-oxidative phase. It plays a vital role in cellular metabolism by participating in the transaldolase and transketolase reactions, which link the PPP to glycolysis and nucleotide biosynthesis. This compound is essential for maintaining redox balance and providing precursors for biosynthetic processes such as nucleotide and aromatic amino acid synthesis. D-Sedoheptulose 7-phosphate is widely studied in biochemistry and metabolic research, particularly for exploring carbohydrate metabolism, enzymatic mechanisms, and pathways crucial for cellular homeostasis and growth.
CAS Number | 2646-35-7 |
Molecular Formula | C₇H₁₅O₁₀P |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5,7-pentahydroxy-6-oxoheptyl] dihydrogen phosphate |
InChI | InChI=1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 |
InChIKey | JDTUMPKOJBQPKX-GBNDHIKLSA-N |
SMILES | C([C@H]([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O)OP(=O)(O)O |