For research use only. Not for therapeutic Use.
D-Serine-2,3,3-d3 (Cat No.:C000826) is a deuterium-labeled form of D-serine, an amino acid, and neurotransmitter involved in various neurological processes. The “2,3,3-d3” notation indicates that three hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This labeling enables precise isotope tracing in research and analytical applications. D-Serine-2,3,3-d3 is used as an internal standard in mass spectrometry and metabolic studies, facilitating accurate quantification and identification of D-serine and its derivatives in biological samples. Its use contributes to a better understanding of D-serine’s role in brain function and its potential therapeutic applications in neurological disorders.
CAS Number | 1414348-52-9 |
Molecular Formula | C₃H₄D₃NO₃ |
Purity | ≥95% |
Solubility | Aqueous Acid (Slightly), Water (Slightly) |
Appearance | White to Off-White Solid |
Storage | RT, Inert atmosphere |
IUPAC Name | (2R)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1/i1D2,2D |
InChIKey | MTCFGRXMJLQNBG-MIRRBZTDSA-N |
SMILES | [2H][C@](C(=O)O)(C([2H])([2H])O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |