D-Talose-1-13C is a stable isotope-labeled form of D-talose, a rare aldohexose sugar, with a carbon-13 atom at the C-1 position. This compound is utilized in biochemical and metabolic research to study carbohydrate metabolism and enzyme interactions. The incorporation of the carbon-13 isotope allows for precise tracking and analysis through NMR spectroscopy and mass spectrometry, providing insights into metabolic pathways and the structural elucidation of carbohydrates. D-Talose-1-13C is particularly useful in pharmaceutical research for investigating glycosylation processes and the development of novel therapeutics targeting metabolic disorders.
Catalog Number | R041405 |
CAS Number | 70849-29-5 |
Synonyms | D(+)-Talose-13C; NSC 224293-13C; |
Molecular Formula | C6H12O6 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (2S,3S,4S,5R)-2,3,4,5,6-pentahydroxy(113C)hexanal |
InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5-,6+/m1/s1/i1+1 |
InChIKey | GZCGUPFRVQAUEE-QXESHIHCSA-N |
SMILES | C([C@H]([C@@H]([C@@H]([C@@H]([13CH]=O)O)O)O)O)O |