For research use only. Not for therapeutic Use.
D-(-)-Tartaric Acid(CAT: R016805) is a chiral organic compound with various applications in the fields of pharmaceuticals, organic chemistry, and material chemistry. Its action is primarily related to its chiral nature, making it a valuable reagent for asymmetric synthesis in organic chemistry. It is widely used to resolve enantiomers and prepare chiral intermediates for pharmaceuticals.
Catalog Number | R016805 |
CAS Number | 147-71-7 |
Synonyms | (2S,3S)-2,3-Dihydroxybutanedioic Acid; [S-(R*,R*)]-2,3-Dihydroxybutanedioic Acid; (-)-Tartaric Acid; (2S,3S)-(-)-Tartaric Acid; (2S,3S)-2,3-Dihydroxysuccinic Acid; (2S,3S)-Tartaric Acid; (S,S)-(-)-Tartaric Acid; (S,S)-Tartaric Acid; D-(-)-Tartaric Ac |
Molecular Formula | C4H6O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,3S)-2,3-dihydroxybutanedioic acid |
InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m0/s1 |
InChIKey | FEWJPZIEWOKRBE-LWMBPPNESA-N |
SMILES | C(C(C(=O)O)O)(C(=O)O)O |