For research use only. Not for therapeutic Use.
D-(+)-Trehalose Dihydrate(Cat No.:R058909), is a disaccharide sugar that consists of two glucose molecules linked together. It naturally occurs in various organisms, including bacteria, fungi, and plants, and plays a vital role as an energy source and protective agent during stress conditions. In the food and pharmaceutical industries, it is employed as a stabilizing and cryoprotective agent, helping preserve the integrity of proteins, enzymes, and other biomolecules during freeze-drying and storage. Due to its non-reducing sugar properties and low hygroscopicity, it’s valued for its ability to extend the shelf life and maintain the quality of various products.
Catalog Number | R058909 |
CAS Number | 6138-23-4 |
Synonyms | Trehalose Dihydrate; α,α-Trehalose Dihydrate; α-D-Glucopyranosyl α-D-Glucopyranoside Dihydrate; |
Molecular Formula | C12H26O13 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room temperature |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol;dihydrate |
InChI | InChI=1S/C12H22O11.2H2O/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12;;/h3-20H,1-2H2;2*1H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-;;/m1../s1 |
InChIKey | DPVHGFAJLZWDOC-PVXXTIHASA-N |
SMILES | C(C1C(C(C(C(O1)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)O.O.O |