For research use only. Not for therapeutic Use.
D-Tyrosine is the D-isomer of the amino acid tyrosine, commonly used in biochemical and pharmaceutical research. It plays a role in neurotransmitter synthesis, particularly in dopamine and norepinephrine pathways. D-Tyrosine is utilized in studies of chiral discrimination, protein structure, and enzyme catalysis. Its unique stereochemistry differentiates it from the L-form, offering insights into racemization processes and the effects of chirality on biological activity. D-Tyrosine serves as a valuable tool in exploring drug design and receptor interactions.
| Catalog Number | R042309 |
| CAS Number | 556-02-5 |
| Synonyms | (2R)-2-Amino-3-(4-hydroxyphenyl)propanoic Acid; (R)-Tyrosine; D-p-Tyrosine; H-D-Tyr-OH; |
| Molecular Formula | C9H11NO3 |
| Purity | ≥95% |
| Target | Tyrosinase |
| Storage | -20°C |
| IUPAC Name | (2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | OUYCCCASQSFEME-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
