For research use only. Not for therapeutic Use.
D-Xylulose(CAT: R041456) is a naturally occurring keto-pentose sugar widely utilized in biochemical, nutritional, and pharmaceutical research. As a critical intermediate in the pentose phosphate pathway, it plays a key role in cellular metabolism and energy production. This compound is particularly valuable for studying carbohydrate metabolism, enzymatic reactions, and as a precursor in the synthesis of bioactive molecules. With its high purity and consistent quality, D-Xylulose is an essential tool for exploring metabolic pathways, developing therapeutic agents, and advancing research in glycobiology and nutrition science.
| Catalog Number | R041456 |
| CAS Number | 551-84-8 |
| Synonyms | D-Threo-pent-2-ulose; |
| Molecular Formula | C5H10O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m1/s1 |
| InChIKey | ZAQJHHRNXZUBTE-WUJLRWPWSA-N |
| SMILES | C(C(C(C(=O)CO)O)O)O |
