For research use only. Not for therapeutic Use.
D4476（Cat No.:I003053） is a highly effective and specific inhibitor of casein kinase 1 (CK1). It demonstrates exceptional cell permeability and inhibits CK1 with an IC50 value of 0.3 μM in vitro. This potent inhibitory activity makes D4476 a valuable tool for studying CK1 signaling pathways and related cellular processes. With its remarkable selectivity and ability to penetrate cells, D4476 serves as a valuable compound for investigating CK1-mediated functions and potential therapeutic applications associated with CK1 dysregulation.
| Catalog Number | I003053 |
| CAS Number | 301836-43-1 |
| Synonyms | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-pyridin-2-yl-1H-imidazol-2-yl]benzamide |
| Molecular Formula | C₂₃H₁₈N₄O₃ |
| Purity | ≥95% |
| Target | CK1 |
| Solubility | DMSO 20 mg/mL |
| Storage | 2-8°C |
| IC50 | 10 uM (IC90 for CK1δ) |
| IUPAC Name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-pyridin-2-yl-1H-imidazol-2-yl]benzamide |
| InChI | InChI=1S/C23H18N4O3/c24-22(28)14-4-6-15(7-5-14)23-26-20(21(27-23)17-3-1-2-10-25-17)16-8-9-18-19(13-16)30-12-11-29-18/h1-10,13H,11-12H2,(H2,24,28)(H,26,27) |
| InChIKey | DPDZHVCKYBCJHW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=C(NC(=N3)C4=CC=C(C=C4)C(=O)N)C5=CC=CC=N5 |
